Cocamide DEA
A mixture of ethanolamides of coconut acid used for a lather-builder and thickener in shampoos and other cosmetics. Coconut acid is compounded with synthetic chemicals and can cause allergic reactions and dessication of skin, scalp, and hair. Toxic. See Triethanolamine.
Cocamide DEA, or cocamide diethanolamine, is a diethanolamide made by reacting the mixture of fatty acids from coconut oils with diethanolamine. It is a viscous liquid and is used as a foaming agent in bath products like shampoos and hand soaps, and in cosmetics as an emulsifying agent. See cocamide for the discussion of the lengths of carbon chains in the molecules in the mixture. The chemical formula of individual components is CH3(CH2)nC(=O)N(CH2CH2OH)2, where n typically ranges from 8 to 18.
 Cocoamide diethanolamine
| |
| Identifiers | |
|---|---|
| ChemSpider |
|
| ECHA InfoCard | 100.065.123 |
| EC Number |
|
CompTox Dashboard (EPA)
|
|
| Properties | |
| CH3(CH2)nC(=O)N(CH2CH2OH)2, n ~ 8-18 | |
| Appearance | Yellowish to yellow viscous liquid |
| Hazards | |
| GHS labelling: | |
 
| |
| Danger | |
| H315, H318, H319 | |
| P264, P280, P302+P352, P305+P351+P338, P310, P321, P332+P313, P337+P313, P362 | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
